cas: 39995-50-1 — see every product listed under this CAS number, including other names
(R)-2,2,2-Trifluoro-N-(1-phenylethyl)acetamide 98% (CAS 39995-50-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A434902-250mg |
| cas | 39995-50-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 2267.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A434902 |
2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide (CAS 39995-50-1) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: 2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide. InChIKey: ZJFCMJDNHPXGBY-SSDOTTSWSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide |
| InChIKey | ZJFCMJDNHPXGBY-SSDOTTSWSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)