cas: 269067-38-1 — see every product listed under this CAS number, including other names
(R)-2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-((DIPHENYL(P-TOLYL)METHYL)THIO)PROPANOIC ACID, 97% (CAS 269067-38-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F794146-25G |
| cas | 269067-38-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 1174.60 Pln | |
| Fluorochem | 100g | 3876.78 Pln | |
| Fluorochem | 5g | 289.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(4-methylphenyl)-diphenylmethyl]sulfanylpropanoic acid (CAS 269067-38-1) is a chemical compound with the molecular formula C38H33NO4S and a molecular weight of 599.7 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(4-methylphenyl)-diphenylmethyl]sulfanylpropanoic acid. InChIKey: PCCZXLMDPCBTSL-DHUJRADRSA-N.
| Molecular formula | C38H33NO4S |
|---|---|
| Molecular weight | 599.7 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(4-methylphenyl)-diphenylmethyl]sulfanylpropanoic acid |
| InChIKey | PCCZXLMDPCBTSL-DHUJRADRSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)