CAS 1349807-46-0 appears in our catalog under these names: Fmoc-n-me-d-cys(trt)-oh, 95%, FMoc–n–me–d–cys(trt)–oh, Fmoc-D-N-Me-Cys(Trt)-OH 98% HPLC(contains~10.0% solvent), FMoc-N-me-d-cys(trt)-oh, 98% HPLC(contains~10.0% solvent), 98% HPLC(contains~10.0% solvent). Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g, 100g, 10g.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-tritylsulfanylpropanoic acid (CAS 1349807-46-0) is a chemical compound with the molecular formula C38H33NO4S and a molecular weight of 599.7 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-tritylsulfanylpropanoic acid. InChIKey: RAKOPMQMPUNRGI-PGUFJCEWSA-N.
| Molecular formula | C38H33NO4S |
|---|---|
| Molecular weight | 599.7 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-tritylsulfanylpropanoic acid |
| InChIKey | RAKOPMQMPUNRGI-PGUFJCEWSA-N |
| SMILES | CN([C@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O)C(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)