CAS 1007840-62-1 appears in our catalog under these names: Fmoc–D–Homocys(Trt)–OH, Fmoc-d-homocys(trt)-oh, 95%, Fmoc-D-HCys(Trt)-OH, Fmoc-D-HoCys(Trt)-OH 95%, Fmoc-D-HomoCys(Trt)-OH, 95%, 95%. Offered by: GLPBio, Combi-blocks, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid (CAS 1007840-62-1) is a chemical compound with the molecular formula C38H33NO4S and a molecular weight of 599.7 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid. InChIKey: FKBGJLDYRSFHBT-PGUFJCEWSA-N.
| Molecular formula | C38H33NO4S |
|---|---|
| Molecular weight | 599.7 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid |
| InChIKey | FKBGJLDYRSFHBT-PGUFJCEWSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SCC[C@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)