cas: 178924-05-5 — see every product listed under this CAS number, including other names
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(((allyloxy)carbonyl)amino)propanoic acid, 98% (CAS 178924-05-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F547069-250MG |
| cas | 178924-05-5 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 117.68 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 924.69 Pln | |
| Fluorochem | 10g | 1773.35 Pln | |
| Fluorochem | 25g | 3293.65 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 770.00 Pln | |
| Chemat | 10g | 1384.40 Pln | |
| Chemat | 25g | 2541.20 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)propanoic acid (CAS 178924-05-5) is a chemical compound with the molecular formula C22H22N2O6 and a molecular weight of 410.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)propanoic acid. InChIKey: MPVGCCAXXFLGIU-LJQANCHMSA-N.
| Molecular formula | C22H22N2O6 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)propanoic acid |
| InChIKey | MPVGCCAXXFLGIU-LJQANCHMSA-N |
| SMILES | C=CCOC(=O)NC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)