cas: 1217731-48-0 — see every product listed under this CAS number, including other names
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-phenylpentanoic acid, 98%, 98% (CAS 1217731-48-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126XS-10g |
| cas | 1217731-48-0 |
| size | 10g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 990.80 Pln | |
| Chemat | 50g | 4197.20 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 25g | 2267.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid (CAS 1217731-48-0) is a chemical compound with the molecular formula C26H25NO4 and a molecular weight of 415.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid. InChIKey: JDBKBGOHVBNXRB-XMMPIXPASA-N.
| Molecular formula | C26H25NO4 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid |
| InChIKey | JDBKBGOHVBNXRB-XMMPIXPASA-N |
| SMILES | C1=CC=C(C=C1)CCC[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)