CAS 959578-11-1 appears in our catalog under these names: Fmoc-L-2-amino-5-phenyl-pentanoic acid, 97%, (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–5–phenylpentanoic acid, Fmoc-Nva(5-phenyl)-OH 98%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-phenylpentanoic acid, 98%, 98%, N-Fmoc-L-2-Aminophenylpentanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 100mg, 500mg, 50g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid (CAS 959578-11-1) is a chemical compound with the molecular formula C26H25NO4 and a molecular weight of 415.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid. InChIKey: JDBKBGOHVBNXRB-DEOSSOPVSA-N.
| Molecular formula | C26H25NO4 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid |
| InChIKey | JDBKBGOHVBNXRB-DEOSSOPVSA-N |
| SMILES | C1=CC=C(C=C1)CCC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)