cas: 287210-83-7 — see every product listed under this CAS number, including other names
(R)-2-((tert-Butoxycarbonyl)(methyl)amino)-4,4-dimethylpentanoic acid, 97%, 97% (CAS 287210-83-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IL39-100mg |
| cas | 287210-83-7 |
| size | 100mg |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 899.60 Pln | |
| Chemat | 500mg | 1547.60 Pln | |
| Chemat | 1g | 1917.20 Pln | |
| Chemat | 5g | 5632.40 Pln | |
| Chemat | 10g | 9347.60 Pln | |
| Chemat | 25g | 16773.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-4,4-dimethyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid (CAS 287210-83-7) is a chemical compound with the molecular formula C13H25NO4 and a molecular weight of 259.34 g/mol. IUPAC name: (2R)-4,4-dimethyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid. InChIKey: IPXPECOIMFVOLR-SECBINFHSA-N.
| Molecular formula | C13H25NO4 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | (2R)-4,4-dimethyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid |
| InChIKey | IPXPECOIMFVOLR-SECBINFHSA-N |
| SMILES | CC(C)(C)C[C@H](C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)