Products 1820572-12-0
CAS 1820572-12-0 is the registry number for methyl (2R)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (2R)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate (CAS 1820572-12-0) is a chemical compound with the molecular formula C13H25NO4 and a molecular weight of 259.34 g/mol. IUPAC name: methyl (2R)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate. InChIKey: XEYQMDIHLQBTQL-SNVBAGLBSA-N.
| Molecular formula | C13H25NO4 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | methyl (2R)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate |
| InChIKey | XEYQMDIHLQBTQL-SNVBAGLBSA-N |
| SMILES | CC(C)C[C@H](C(=O)OC)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)