Products 146453-32-9

CAS 146453-32-9 is the registry number for (R)-4-(Boc-amino)-6-methylheptanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(4R)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid (CAS 146453-32-9) is a chemical compound with the molecular formula C13H25NO4 and a molecular weight of 259.34 g/mol. IUPAC name: (4R)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid. InChIKey: ILHMTULQPDRVLS-SNVBAGLBSA-N.

Identity
Molecular formulaC13H25NO4
Molecular weight259.34 g/mol
IUPAC name(4R)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid
InChIKeyILHMTULQPDRVLS-SNVBAGLBSA-N
SMILESCC(C)C[C@@H](CCC(=O)O)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)