cas: 154731-88-1 — see every product listed under this CAS number, including other names
(R)-2-((tert-butoxycarbonyl)amino)-4-cyclohexylbutanoic acid, 97% (CAS 154731-88-1) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 10g, 100mg, 250mg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F982641-500MG |
| cas | 154731-88-1 |
| size | 500mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 362.39 Pln | |
| Fluorochem | 1g | 430.07 Pln | |
| Fluorochem | 5g | 1211.05 Pln | |
| Fluorochem | 10g | 1778.56 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 500mg | 285.20 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 976.40 Pln | |
| Chemat | 10g | 1845.20 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2R)-4-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 154731-88-1) is a chemical compound with the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. IUPAC name: (2R)-4-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: CMORIBDLPGOGNO-GFCCVEGCSA-N.
| Molecular formula | C15H27NO4 |
|---|---|
| Molecular weight | 285.38 g/mol |
| IUPAC name | (2R)-4-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | CMORIBDLPGOGNO-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC1CCCCC1)C(=O)O |
Computed by PubChem (NCBI)