Products 2270910-76-2

CAS 2270910-76-2 is the registry number for Trans 4-(4-tert-butoxycarbonylamino-cyclohexyl)-butyric acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]butanoic acid (CAS 2270910-76-2) is a chemical compound with the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. IUPAC name: 4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]butanoic acid. InChIKey: VDOWFMPWHAECQL-UHFFFAOYSA-N.

Identity
Molecular formulaC15H27NO4
Molecular weight285.38 g/mol
IUPAC name4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]butanoic acid
InChIKeyVDOWFMPWHAECQL-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CCC(CC1)CCCC(=O)O

Computed by PubChem (NCBI)