CAS 460720-14-3 appears in our catalog under these names: (2S)-2-([(2S)-4-Cyclohexyl-1-ethoxy-1-oxobutan-2-yl]amino)propanoic acid, 95%, Enalapril EP Impurity G, (AlphaS)-Cyclohexanebutanoic Acid Alpha-(((1S)-1-Carboxyethyl)amino)cyclohexanebutanoic Acid Alpha-Ethyl Ester, (S)-2-(((S)-4-Cyclohexyl-1-ethoxy-1-oxobutan-2-yl)amino)propanoic acid, 95%, Enalapril maleate impurity G. Offered by: Combi-blocks, Chemat Brand, TRC, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 250mg, on request, 10mg, 25mg.
(2S)-2-[[(2S)-4-cyclohexyl-1-ethoxy-1-oxobutan-2-yl]amino]propanoic acid (CAS 460720-14-3) is a chemical compound with the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. IUPAC name: (2S)-2-[[(2S)-4-cyclohexyl-1-ethoxy-1-oxobutan-2-yl]amino]propanoic acid. InChIKey: SSKKXRIKYHEFTJ-AAEUAGOBSA-N.
| Molecular formula | C15H27NO4 |
|---|---|
| Molecular weight | 285.38 g/mol |
| IUPAC name | (2S)-2-[[(2S)-4-cyclohexyl-1-ethoxy-1-oxobutan-2-yl]amino]propanoic acid |
| InChIKey | SSKKXRIKYHEFTJ-AAEUAGOBSA-N |
| SMILES | CCOC(=O)[C@H](CCC1CCCCC1)N[C@@H](C)C(=O)O |
Computed by PubChem (NCBI)