(R)-2-(5-Bromopyridin-2-yl)-4-isopropyl-4,5-dihydrooxazole, 97% 99%ee
cas: 2757083-30-8 — see every product listed under this CAS number, including other names
(R)-2-(5-Bromopyridin-2-yl)-4-isopropyl-4,5-dihydrooxazole, 97% 99%ee (CAS 2757083-30-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1493912-100mg |
| cas | 2757083-30-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 615.13 Pln | |
| Ambeed | 1g | 1755.44 Pln | |
| Chemat | 50mg | 237.20 Pln | |
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 813.20 Pln | |
| Chemat | 1g | 2315.60 Pln | |
| Fluorochem | 100mg | 700.81 Pln | |
| Fluorochem | 50mg | 414.46 Pln | |
| Fluorochem | 250mg | 1507.82 Pln | |
| Fluorochem | 1g | 4288.09 Pln | |
| BLDpharm | 50mg | 236.61 Pln | |
| BLDpharm | 100mg | 325.47 Pln | |
| BLDpharm | 250mg | 658.68 Pln | |
| BLDpharm | 1g | 1891.58 Pln |
properties
| purity | 97% 99%ee |
|---|---|
| delivery time | 1-2 weeks |
(4R)-2-(5-bromo-2-pyridinyl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole (CAS 2757083-30-8) is a chemical compound with the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. IUPAC name: (4R)-2-(5-bromo-2-pyridinyl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole. InChIKey: UIYNKZRZVDJOPI-JTQLQIEISA-N.
| Molecular formula | C11H13BrN2O |
|---|---|
| Molecular weight | 269.14 g/mol |
| IUPAC name | (4R)-2-(5-bromo-2-pyridinyl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | UIYNKZRZVDJOPI-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H]1COC(=N1)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)