CAS 302953-16-8 is the registry number for N-Cyclopentyl 5-bromonicotinamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
5-bromo-N-cyclopentylpyridine-3-carboxamide (CAS 302953-16-8) is a chemical compound with the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. IUPAC name: 5-bromo-N-cyclopentylpyridine-3-carboxamide. InChIKey: JYWQXAJRHYOMIX-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O |
|---|---|
| Molecular weight | 269.14 g/mol |
| IUPAC name | 5-bromo-N-cyclopentylpyridine-3-carboxamide |
| InChIKey | JYWQXAJRHYOMIX-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC(=O)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)