CAS 1300031-82-6 is the registry number for N-(6-Bromo-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl)formamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(6-bromo-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl)formamide (CAS 1300031-82-6) is a chemical compound with the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. IUPAC name: N-(6-bromo-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl)formamide. InChIKey: DFXDVASSVZLSKJ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O |
|---|---|
| Molecular weight | 269.14 g/mol |
| IUPAC name | N-(6-bromo-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl)formamide |
| InChIKey | DFXDVASSVZLSKJ-UHFFFAOYSA-N |
| SMILES | CC1CC(C2=C(N1)C=CC(=C2)Br)NC=O |
Computed by PubChem (NCBI)