CAS 2828439-75-2 appears in our catalog under these names: (R)-2-(Benzo[b]thiophen-2-yl)-4-methyl-4,5-dihydrooxazole, 98%, (R)-2-(Benzo[b]thiophen-2-yl)-4-methyl-4,5-dihydrooxazole, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 5g, 1g, 250mg.
(4R)-2-(1-benzothiophen-2-yl)-4-methyl-4,5-dihydro-1,3-oxazole (CAS 2828439-75-2) is a chemical compound with the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. IUPAC name: (4R)-2-(1-benzothiophen-2-yl)-4-methyl-4,5-dihydro-1,3-oxazole. InChIKey: ZTTLPQXEHADBIG-MRVPVSSYSA-N.
| Molecular formula | C12H11NOS |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | (4R)-2-(1-benzothiophen-2-yl)-4-methyl-4,5-dihydro-1,3-oxazole |
| InChIKey | ZTTLPQXEHADBIG-MRVPVSSYSA-N |
| SMILES | C[C@@H]1COC(=N1)C2=CC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)