CAS 926234-18-6 appears in our catalog under these names: 6-Methoxynaphthalene-2-carbothioamide, 6-Methoxynaphthalene-2-carbothioamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
6-methoxynaphthalene-2-carbothioamide (CAS 926234-18-6) is a chemical compound with the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. IUPAC name: 6-methoxynaphthalene-2-carbothioamide. InChIKey: SZNBNJFTZHUGPB-UHFFFAOYSA-N.
| Molecular formula | C12H11NOS |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | 6-methoxynaphthalene-2-carbothioamide |
| InChIKey | SZNBNJFTZHUGPB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C(=S)N |
Computed by PubChem (NCBI)