CAS 22731-83-5 appears in our catalog under these names: (Diphenylimino-lambda6-sulfanyl)one, 98%, Sulfonimidoyldibenzene, S,​S-​Diphenyl-sulfoximine, Sulfonimidoyldibenzene 97%, Sulfonimidoyldibenzene, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg, 10g.
Imino-oxo-diphenyl-lambda6-sulfane (CAS 22731-83-5) is a chemical compound with the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. IUPAC name: imino-oxo-diphenyl-lambda6-sulfane. InChIKey: KNPJTNDEHOFWKA-UHFFFAOYSA-N.
| Molecular formula | C12H11NOS |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | imino-oxo-diphenyl-lambda6-sulfane |
| InChIKey | KNPJTNDEHOFWKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=N)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)