cas: 60479-64-3 — see every product listed under this CAS number, including other names
(R)-2-[Bis(phenylmethyl)amino]-1-propanol, 95%, 95% (CAS 60479-64-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EH99-250mg |
| cas | 60479-64-3 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 717.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(dibenzylamino)propan-1-ol (CAS 60479-64-3) is a chemical compound with the molecular formula C17H21NO and a molecular weight of 255.35 g/mol. IUPAC name: (2R)-2-(dibenzylamino)propan-1-ol. InChIKey: IEEFFKXJADVWJO-OAHLLOKOSA-N.
| Molecular formula | C17H21NO |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | (2R)-2-(dibenzylamino)propan-1-ol |
| InChIKey | IEEFFKXJADVWJO-OAHLLOKOSA-N |
| SMILES | C[C@H](CO)N(CC1=CC=CC=C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)