CAS 71653-81-1 is the registry number for (1R,2S)-2-(Isopropylamino)-1,2-diphenylethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(1R,2S)-1,2-diphenyl-2-(propan-2-ylamino)ethanol (CAS 71653-81-1) is a chemical compound with the molecular formula C17H21NO and a molecular weight of 255.35 g/mol. IUPAC name: (1R,2S)-1,2-diphenyl-2-(propan-2-ylamino)ethanol. InChIKey: ILABSMRKFLZNPK-DLBZAZTESA-N.
| Molecular formula | C17H21NO |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | (1R,2S)-1,2-diphenyl-2-(propan-2-ylamino)ethanol |
| InChIKey | ILABSMRKFLZNPK-DLBZAZTESA-N |
| SMILES | CC(C)N[C@@H](C1=CC=CC=C1)[C@@H](C2=CC=CC=C2)O |
Computed by PubChem (NCBI)