CAS 2111905-49-6 is the registry number for 4-(1,2,2,4-Tetramethyl-1,2-dihydroquinolin-6-yl)but-3-en-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(E)-4-(1,2,2,4-tetramethylquinolin-6-yl)but-3-en-2-one (CAS 2111905-49-6) is a chemical compound with the molecular formula C17H21NO and a molecular weight of 255.35 g/mol. IUPAC name: (E)-4-(1,2,2,4-tetramethylquinolin-6-yl)but-3-en-2-one. InChIKey: MMVNNESDOYZBQH-VOTSOKGWSA-N.
| Molecular formula | C17H21NO |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | (E)-4-(1,2,2,4-tetramethylquinolin-6-yl)but-3-en-2-one |
| InChIKey | MMVNNESDOYZBQH-VOTSOKGWSA-N |
| SMILES | CC1=CC(N(C2=C1C=C(C=C2)/C=C/C(=O)C)C)(C)C |
Computed by PubChem (NCBI)