(R)-2-Amino-2-(3-bromophenyl)ethan-1-ol hydrochloride, 95%
cas: 2829292-62-6 — see every product listed under this CAS number, including other names
(R)-2-Amino-2-(3-bromophenyl)ethan-1-ol hydrochloride, 95% (CAS 2829292-62-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A409577-100mg |
| cas | 2829292-62-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 275.81 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 2756.69 Pln | |
| BLDpharm | 100mg | 292.14 Pln | |
| BLDpharm | 250mg | 375.45 Pln | |
| BLDpharm | 1g | 891.93 Pln | |
| BLDpharm | 5g | 2968.98 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 947.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2R)-2-amino-2-(3-bromophenyl)ethanol;hydrochloride (CAS 2829292-62-6) is a chemical compound with the molecular formula C8H11BrClNO and a molecular weight of 252.53 g/mol. IUPAC name: (2R)-2-amino-2-(3-bromophenyl)ethanol;hydrochloride. InChIKey: MIVIGGHRMIPLJI-QRPNPIFTSA-N.
| Molecular formula | C8H11BrClNO |
|---|---|
| Molecular weight | 252.53 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-bromophenyl)ethanol;hydrochloride |
| InChIKey | MIVIGGHRMIPLJI-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)