cas: 1916569-82-8 — see every product listed under this CAS number, including other names
(R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride, 97%, 97% (CAS 1916569-82-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113FE4-25g |
| cas | 1916569-82-8 |
| size | 25g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 4058.00 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2267.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-amino-2-(4-bromophenyl)ethanol;hydrochloride (CAS 1916569-82-8) is a chemical compound with the molecular formula C8H11BrClNO and a molecular weight of 252.53 g/mol. IUPAC name: (2R)-2-amino-2-(4-bromophenyl)ethanol;hydrochloride. InChIKey: PQQGURGSEYFRCS-QRPNPIFTSA-N.
| Molecular formula | C8H11BrClNO |
|---|---|
| Molecular weight | 252.53 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-bromophenyl)ethanol;hydrochloride |
| InChIKey | PQQGURGSEYFRCS-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CO)N)Br.Cl |
Computed by PubChem (NCBI)