cas: 264903-53-9 — see every product listed under this CAS number, including other names
(R)-2-Amino-5-phenylpent-4-enoic acid, 97% (CAS 264903-53-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239203-250MG |
| cas | 264903-53-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 2075.33 Pln | |
| Fluorochem | 10g | 3704.96 Pln | |
| Fluorochem | 25g | 7890.99 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(E,2R)-2-amino-5-phenylpent-4-enoic acid (CAS 264903-53-9) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: (E,2R)-2-amino-5-phenylpent-4-enoic acid. InChIKey: MCGSKGBMVBECNS-LJJSCBMDSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | (E,2R)-2-amino-5-phenylpent-4-enoic acid |
| InChIKey | MCGSKGBMVBECNS-LJJSCBMDSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)