Products 52161-76-9
CAS 52161-76-9 is the registry number for (2S,4E)-2-Amino-5-phenyl-4-pentenoic Acid. Offered by: TRC. Available pack sizes: 100mg.
(E,2S)-2-amino-5-phenylpent-4-enoic acid (CAS 52161-76-9) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: (E,2S)-2-amino-5-phenylpent-4-enoic acid. InChIKey: MCGSKGBMVBECNS-QBBOHKLWSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | (E,2S)-2-amino-5-phenylpent-4-enoic acid |
| InChIKey | MCGSKGBMVBECNS-QBBOHKLWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
2-Amino-5-phenyl-(2s)-4-pentenoic acid, L-Styrylalanine, (S)-2-Amino-5-phenylpent-4-enoic acid, 3-Styryl-L-alanine, (E,2S)-2-amino-5-phenylpent-4-enoic acid, (E)-L-Styrylalanine, (2S,4E)-2-amino-5-phenylpent-4-enoic acid, (2S,4E)-2-Amino-5-phenyl-4-pentenoic acid, L-Ala(styryl)-OH, (E,2S)-2-amino-5-phenyl-pent-4-enoic Acid