cas: 1313710-31-4 — see every product listed under this CAS number, including other names
(R)-2-Methyl-3,5-dioxo-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%, 95% (CAS 1313710-31-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111W1M-1g |
| cas | 1313710-31-4 |
| size | 1g |
| availability | 49g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3251.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2R)-2-methyl-3,5-dioxopyrrolidine-1-carboxylate (CAS 1313710-31-4) is a chemical compound with the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. IUPAC name: tert-butyl (2R)-2-methyl-3,5-dioxopyrrolidine-1-carboxylate. InChIKey: XLXSMICXDWTYCA-ZCFIWIBFSA-N.
| Molecular formula | C10H15NO4 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | tert-butyl (2R)-2-methyl-3,5-dioxopyrrolidine-1-carboxylate |
| InChIKey | XLXSMICXDWTYCA-ZCFIWIBFSA-N |
| SMILES | C[C@@H]1C(=O)CC(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)