CAS 1450828-51-9 appears in our catalog under these names: tert-Butyl 2-methyl-3,5-dioxopyrrolidine-1-carboxylate, 95%, N-Boc-5-methylpyrrolidine-2,4-dione, 97%, N–Boc–5–methylpyrrolidine–2，4–dione, N-Boc-5-methylpyrrolidine-2,4-dione. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
Tert-butyl 2-methyl-3,5-dioxopyrrolidine-1-carboxylate (CAS 1450828-51-9) is a chemical compound with the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. IUPAC name: tert-butyl 2-methyl-3,5-dioxopyrrolidine-1-carboxylate. InChIKey: XLXSMICXDWTYCA-UHFFFAOYSA-N.
| Molecular formula | C10H15NO4 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | tert-butyl 2-methyl-3,5-dioxopyrrolidine-1-carboxylate |
| InChIKey | XLXSMICXDWTYCA-UHFFFAOYSA-N |
| SMILES | CC1C(=O)CC(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)