(R)-3,3-Difluoro-1-methylpiperidin-4-amine dihydrochloride, 95%
cas: 2891580-30-4 — see every product listed under this CAS number, including other names
(R)-3,3-Difluoro-1-methylpiperidin-4-amine dihydrochloride, 95% (CAS 2891580-30-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2700469-50mg |
| cas | 2891580-30-4 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 720.81 Pln | |
| Ambeed | 100mg | 1171.38 Pln | |
| Ambeed | 250mg | 1922.31 Pln | |
| Ambeed | 1g | 4887.12 Pln | |
| Ambeed | 5g | 19332.94 Pln | |
| Chemat | 100mg | 774.80 Pln | |
| Chemat | 250mg | 1302.80 Pln | |
| BLDpharm | 50mg | 764.20 Pln | |
| BLDpharm | 100mg | 1247.36 Pln | |
| BLDpharm | 250mg | 2069.30 Pln | |
| BLDpharm | 1g | 5245.96 Pln | |
| BLDpharm | 5g | 20768.27 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(4R)-3,3-difluoro-1-methylpiperidin-4-amine;dihydrochloride (CAS 2891580-30-4) is a chemical compound with the molecular formula C6H14Cl2F2N2 and a molecular weight of 223.09 g/mol. IUPAC name: (4R)-3,3-difluoro-1-methylpiperidin-4-amine;dihydrochloride. InChIKey: IYJRUHHMTXAKRQ-ZJIMSODOSA-N.
| Molecular formula | C6H14Cl2F2N2 |
|---|---|
| Molecular weight | 223.09 g/mol |
| IUPAC name | (4R)-3,3-difluoro-1-methylpiperidin-4-amine;dihydrochloride |
| InChIKey | IYJRUHHMTXAKRQ-ZJIMSODOSA-N |
| SMILES | CN1CC[C@H](C(C1)(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)