Products 2891580-30-4
CAS 2891580-30-4 appears in our catalog under these names: (R)-3,3-Difluoro-1-methylpiperidin-4-amine dihydrochloride, 95%, 95%, (R)-3,3-Difluoro-1-methylpiperidin-4-amine dihydrochloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
(4R)-3,3-difluoro-1-methylpiperidin-4-amine;dihydrochloride (CAS 2891580-30-4) is a chemical compound with the molecular formula C6H14Cl2F2N2 and a molecular weight of 223.09 g/mol. IUPAC name: (4R)-3,3-difluoro-1-methylpiperidin-4-amine;dihydrochloride. InChIKey: IYJRUHHMTXAKRQ-ZJIMSODOSA-N.
| Molecular formula | C6H14Cl2F2N2 |
|---|---|
| Molecular weight | 223.09 g/mol |
| IUPAC name | (4R)-3,3-difluoro-1-methylpiperidin-4-amine;dihydrochloride |
| InChIKey | IYJRUHHMTXAKRQ-ZJIMSODOSA-N |
| SMILES | CN1CC[C@H](C(C1)(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)