Products 2816818-12-7
CAS 2816818-12-7 is the registry number for (S)-3,3-difluoro-1-methylpiperidin-4-amine dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(4S)-3,3-difluoro-1-methylpiperidin-4-amine;dihydrochloride (CAS 2816818-12-7) is a chemical compound with the molecular formula C6H14Cl2F2N2 and a molecular weight of 223.09 g/mol. IUPAC name: (4S)-3,3-difluoro-1-methylpiperidin-4-amine;dihydrochloride. InChIKey: IYJRUHHMTXAKRQ-XRIGFGBMSA-N.
| Molecular formula | C6H14Cl2F2N2 |
|---|---|
| Molecular weight | 223.09 g/mol |
| IUPAC name | (4S)-3,3-difluoro-1-methylpiperidin-4-amine;dihydrochloride |
| InChIKey | IYJRUHHMTXAKRQ-XRIGFGBMSA-N |
| SMILES | CN1CC[C@@H](C(C1)(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)