cas: 269396-68-1 — see every product listed under this CAS number, including other names
(R)-3-((tert-Butoxycarbonyl)amino)-4-(pyridin-4-yl)butanoic acid, 95+% (CAS 269396-68-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A265156-250mg |
| cas | 269396-68-1 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 2439.64 Pln | |
| AmBeed | 5g | 28284.34 Pln | |
| AmBeed | 1g | 7120.33 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridin-4-ylbutanoic acid (CAS 269396-68-1) is a chemical compound with the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridin-4-ylbutanoic acid. InChIKey: BYTKQINZDKLYGV-LLVKDONJSA-N.
| Molecular formula | C14H20N2O4 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridin-4-ylbutanoic acid |
| InChIKey | BYTKQINZDKLYGV-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=NC=C1)CC(=O)O |
Computed by PubChem (NCBI)