CAS 187035-35-4 appears in our catalog under these names: methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-3-(pyridin-2-yl)propanoate, 96%, Methyl (2S)-2-{((tert-butoxy)carbonyl)amino}-3-(pyridin-2-yl)propanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-2-ylpropanoate (CAS 187035-35-4) is a chemical compound with the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-2-ylpropanoate. InChIKey: YLRHCEYDKOZKIJ-NSHDSACASA-N.
| Molecular formula | C14H20N2O4 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-2-ylpropanoate |
| InChIKey | YLRHCEYDKOZKIJ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=N1)C(=O)OC |
Computed by PubChem (NCBI)