Products 1860028-31-4
CAS 1860028-31-4 appears in our catalog under these names: Bis(2-azabicyclo[2.2.1]hept-5-ene) oxalic acid, 95%, 2-Azabicyclo(2.2.1)hept-5-ene hemioxalate, 97%, bis(2-azabicyclo[2.2.1]hept-5-ene) oxalic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 500mg, 10g.
Bis(2-azabicyclo[2.2.1]hept-5-ene);oxalic acid (CAS 1860028-31-4) is a chemical compound with the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. IUPAC name: bis(2-azabicyclo[2.2.1]hept-5-ene);oxalic acid. InChIKey: LHAUUSJAWPOZPC-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O4 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | bis(2-azabicyclo[2.2.1]hept-5-ene);oxalic acid |
| InChIKey | LHAUUSJAWPOZPC-UHFFFAOYSA-N |
| SMILES | C1C2CNC1C=C2.C1C2CNC1C=C2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)