Products 33900-24-2

CAS 33900-24-2 is the registry number for N-(tert-Butoxycarbonyl)-L-methionine methyl ester, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate (CAS 33900-24-2) is a chemical compound with the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate. InChIKey: OOVXDDGVDXJGQX-QMMMGPOBSA-N.

Identity
Molecular formulaC11H21NO4S
Molecular weight263.36 g/mol
IUPAC namemethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate
InChIKeyOOVXDDGVDXJGQX-QMMMGPOBSA-N
SMILESCC(C)(C)OC(=O)N[C@@H](CCSC)C(=O)OC

Computed by PubChem (NCBI)