Products 1282426-51-0

CAS 1282426-51-0 is the registry number for 3-[1-(Propane-2-sulfonyl)-piperidin-4-yl]-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(1-propan-2-ylsulfonylpiperidin-4-yl)propanoic acid (CAS 1282426-51-0) is a chemical compound with the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. IUPAC name: 3-(1-propan-2-ylsulfonylpiperidin-4-yl)propanoic acid. InChIKey: DQZZTDPVOIHKAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H21NO4S
Molecular weight263.36 g/mol
IUPAC name3-(1-propan-2-ylsulfonylpiperidin-4-yl)propanoic acid
InChIKeyDQZZTDPVOIHKAZ-UHFFFAOYSA-N
SMILESCC(C)S(=O)(=O)N1CCC(CC1)CCC(=O)O

Computed by PubChem (NCBI)