cas: 444335-16-4 — see every product listed under this CAS number, including other names
(R)-3-(4-Bromo-3-fluorophenyl)-5-(hydroxymethyl)oxazolidin-2-one, 95% (CAS 444335-16-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224564-1G |
| cas | 444335-16-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 268.67 Pln | |
| Fluorochem | 25g | 544.62 Pln | |
| Fluorochem | 100g | 1924.34 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(5R)-3-(4-bromo-3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one (CAS 444335-16-4) is a chemical compound with the molecular formula C10H9BrFNO3 and a molecular weight of 290.09 g/mol. IUPAC name: (5R)-3-(4-bromo-3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one. InChIKey: UGBKYDASQNOIHP-SSDOTTSWSA-N.
| Molecular formula | C10H9BrFNO3 |
|---|---|
| Molecular weight | 290.09 g/mol |
| IUPAC name | (5R)-3-(4-bromo-3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| InChIKey | UGBKYDASQNOIHP-SSDOTTSWSA-N |
| SMILES | C1[C@@H](OC(=O)N1C2=CC(=C(C=C2)Br)F)CO |
Computed by PubChem (NCBI)