CAS 2923867-74-5 is the registry number for Methyl 3-acetyl-2-amino-4-bromo-5-fluorobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-acetyl-2-amino-4-bromo-5-fluorobenzoate (CAS 2923867-74-5) is a chemical compound with the molecular formula C10H9BrFNO3 and a molecular weight of 290.09 g/mol. IUPAC name: methyl 3-acetyl-2-amino-4-bromo-5-fluorobenzoate. InChIKey: WFDONTOOTRZPKJ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrFNO3 |
|---|---|
| Molecular weight | 290.09 g/mol |
| IUPAC name | methyl 3-acetyl-2-amino-4-bromo-5-fluorobenzoate |
| InChIKey | WFDONTOOTRZPKJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1Br)F)C(=O)OC)N |
Computed by PubChem (NCBI)