CAS 2044710-49-6 is the registry number for Tedizolid Impurity 63. Offered by: Chemat Brand. Available pack sizes: on request.
(5R)-3-(2-bromo-5-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one (CAS 2044710-49-6) is a chemical compound with the molecular formula C10H9BrFNO3 and a molecular weight of 290.09 g/mol. IUPAC name: (5R)-3-(2-bromo-5-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one. InChIKey: YWKHBFVOAMKIKE-SSDOTTSWSA-N.
| Molecular formula | C10H9BrFNO3 |
|---|---|
| Molecular weight | 290.09 g/mol |
| IUPAC name | (5R)-3-(2-bromo-5-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| InChIKey | YWKHBFVOAMKIKE-SSDOTTSWSA-N |
| SMILES | C1[C@@H](OC(=O)N1C2=C(C=CC(=C2)F)Br)CO |
Computed by PubChem (NCBI)