cas: 748128-33-8 — see every product listed under this CAS number, including other names
(R)-3-(M-Tolyl)-beta-alanine, 98%, 98% (CAS 748128-33-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ICK6-250mg |
| cas | 748128-33-8 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 1216.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-amino-3-(3-methylphenyl)propanoic acid (CAS 748128-33-8) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (3R)-3-amino-3-(3-methylphenyl)propanoic acid. InChIKey: HMLYKNGYKKJNLC-SECBINFHSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (3R)-3-amino-3-(3-methylphenyl)propanoic acid |
| InChIKey | HMLYKNGYKKJNLC-SECBINFHSA-N |
| SMILES | CC1=CC(=CC=C1)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)