Products 56564-52-4
CAS 56564-52-4 appears in our catalog under these names: N-Methyl-D-phenylalanine, 98%, N–Me–D–Phe–OH · HCl, N–Me–D–Phe–OH, H-D-MePhe-OH, N-alpha-Methyl-D-phenylalanine hydrochloride. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 5000mg.
(2R)-2-(methylamino)-3-phenylpropanoic acid (CAS 56564-52-4) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (2R)-2-(methylamino)-3-phenylpropanoic acid. InChIKey: SCIFESDRCALIIM-SECBINFHSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (2R)-2-(methylamino)-3-phenylpropanoic acid |
| InChIKey | SCIFESDRCALIIM-SECBINFHSA-N |
| SMILES | CN[C@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
D-Phenylalanine, N-methyl-, d-n-methylphenylalanine, N-Methylphenylalanine, D-, (R)-2-Methylamino-3-phenylpropionic acid, N-methyl-d-phenylalanine, (R)-2-(Methylamino)-3-phenylpropanoic acid, (2R)-2-(methylamino)-3-phenylpropanoic acid, N-Me-D-Phe-OH, Methyl-D-phenylalanine, (2R)-2-(methylamino)-3-phenyl-propanoic acid