CAS 131683-27-7 appears in our catalog under these names: (S)-3-Amino-2-benzylpropanoic acid, 95%, (S)–3–amino–2–benzylpropanoic acid, (S)-3-Amino-2-benzylpropionic acid, 95%, 95%, (S)-3-Amino-2-benzylpropanoic acid, 95+%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg.
(2S)-2-(aminomethyl)-3-phenylpropanoic acid (CAS 131683-27-7) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (2S)-2-(aminomethyl)-3-phenylpropanoic acid. InChIKey: DJYVEBBGKNAHKE-VIFPVBQESA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (2S)-2-(aminomethyl)-3-phenylpropanoic acid |
| InChIKey | DJYVEBBGKNAHKE-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CN)C(=O)O |
Computed by PubChem (NCBI)