cas: 1213362-28-7 — see every product listed under this CAS number, including other names
(R)-3-Amino-3-(4-chlorophenyl)propan-1-ol 97% (CAS 1213362-28-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A609213-100mg |
| cas | 1213362-28-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 770.88 Pln | |
| Ambeed | 1g | 1888.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A609213 |
(3R)-3-amino-3-(4-chlorophenyl)propan-1-ol (CAS 1213362-28-7) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: (3R)-3-amino-3-(4-chlorophenyl)propan-1-ol. InChIKey: JGNACDMQJLVKIU-SECBINFHSA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-chlorophenyl)propan-1-ol |
| InChIKey | JGNACDMQJLVKIU-SECBINFHSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CCO)N)Cl |
Computed by PubChem (NCBI)