cas: 1213362-28-7 — see every product listed under this CAS number, including other names
(R)-3-Amino-3-(4-chlorophenyl)propan-1-ol, 97% (CAS 1213362-28-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A609213-5g |
| cas | 1213362-28-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10030.30 Pln | |
| Fluorochem | 100mg | 502.97 Pln | |
| Fluorochem | 250mg | 924.69 Pln | |
| Fluorochem | 1g | 1934.75 Pln | |
| Fluorochem | 5g | 5693.85 Pln | |
| Fluorochem | 10g | 9452.94 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3R)-3-amino-3-(4-chlorophenyl)propan-1-ol (CAS 1213362-28-7) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: (3R)-3-amino-3-(4-chlorophenyl)propan-1-ol. InChIKey: JGNACDMQJLVKIU-SECBINFHSA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-chlorophenyl)propan-1-ol |
| InChIKey | JGNACDMQJLVKIU-SECBINFHSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CCO)N)Cl |
Computed by PubChem (NCBI)