cas: 927819-90-7 — see every product listed under this CAS number, including other names
(R)-3-Benzyloxy-pyrrolidine hydrochloride, 98% (CAS 927819-90-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048336-250MG |
| cas | 927819-90-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 1g | 877.83 Pln | |
| Fluorochem | 5g | 3043.74 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-3-phenylmethoxypyrrolidine;hydrochloride (CAS 927819-90-7) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: (3R)-3-phenylmethoxypyrrolidine;hydrochloride. InChIKey: HIPRPABXTKKPPY-RFVHGSKJSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | (3R)-3-phenylmethoxypyrrolidine;hydrochloride |
| InChIKey | HIPRPABXTKKPPY-RFVHGSKJSA-N |
| SMILES | C1CNC[C@@H]1OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)