(R)-3-Benzyloxypyrrolidine hydrochloride, 98%, 98%
cas: 927819-90-7 — see every product listed under this CAS number, including other names
(R)-3-Benzyloxypyrrolidine hydrochloride, 98%, 98% (CAS 927819-90-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GSNE-100mg |
| cas | 927819-90-7 |
| size | 100mg |
| availability | 100g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 2541.20 Pln | |
| Chemat | 50g | 4197.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-phenylmethoxypyrrolidine;hydrochloride (CAS 927819-90-7) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: (3R)-3-phenylmethoxypyrrolidine;hydrochloride. InChIKey: HIPRPABXTKKPPY-RFVHGSKJSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | (3R)-3-phenylmethoxypyrrolidine;hydrochloride |
| InChIKey | HIPRPABXTKKPPY-RFVHGSKJSA-N |
| SMILES | C1CNC[C@@H]1OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-3-Benzyloxypyrrolidine hydrochloride, (R)-3-(Benzyloxy)pyrrolidine Hydrochloride, (3R)-3-benzyloxypyrrolidine hydrochloride, (3R)-3-phenylmethoxypyrrolidine;hydrochloride, (R)-3-Benzyloxypyrrolidinehydrochloride, (3R)-3-benzyloxypyrrolidine;hydrochloride, (R)-3-Benzyloxypyrrolidine HCl, HIPRPABXTKKPPY-RFVHGSKJSA-N, (3R)-3-(Benzyloxy)pyrrolidine--hydrogen chloride (1/1)