cas: 569660-97-5 — see every product listed under this CAS number, including other names
(R)-3-Bromo-pyrrolidine-1-carboxylic acid tert-butyl ester, 96% (CAS 569660-97-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F088272-100MG |
| cas | 569660-97-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 482.14 Pln | |
| Fluorochem | 5g | 1580.71 Pln | |
| Fluorochem | 10g | 2575.15 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3R)-3-bromopyrrolidine-1-carboxylate (CAS 569660-97-5) is a chemical compound with the molecular formula C9H16BrNO2 and a molecular weight of 250.13 g/mol. IUPAC name: tert-butyl (3R)-3-bromopyrrolidine-1-carboxylate. InChIKey: QJTKPXFJOXKUEY-SSDOTTSWSA-N.
| Molecular formula | C9H16BrNO2 |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | tert-butyl (3R)-3-bromopyrrolidine-1-carboxylate |
| InChIKey | QJTKPXFJOXKUEY-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)Br |
Computed by PubChem (NCBI)