CAS 1508-46-9 appears in our catalog under these names: Tiotropium Bromide EP Impurity G Bromide, Tiotropium EP Impurity G, Tiotropium Bromide Impurity 7（Tiotropium Bromide EP Impurity G）, Scopine Methobromide, >95% (HPLC), Tiotropium Bromide EP Impurity G. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 5mg.
9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-ol bromide (CAS 1508-46-9) is a chemical compound with the molecular formula C9H16BrNO2 and a molecular weight of 250.13 g/mol. IUPAC name: 9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-ol bromide. InChIKey: IKDFZBCJDLZSNH-UHFFFAOYSA-M.
| Molecular formula | C9H16BrNO2 |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-ol bromide |
| InChIKey | IKDFZBCJDLZSNH-UHFFFAOYSA-M |
| SMILES | C[N+]1(C2CC(CC1C3C2O3)O)C.[Br-] |
Computed by PubChem (NCBI)