CAS 1629245-79-9 appears in our catalog under these names: Edoxaban Impurity 66, Edoxaban Impurity 81. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(1S,3S,4S)-4-bromo-3-hydroxy-N,N-dimethylcyclohexane-1-carboxamide (CAS 1629245-79-9) is a chemical compound with the molecular formula C9H16BrNO2 and a molecular weight of 250.13 g/mol. IUPAC name: (1S,3S,4S)-4-bromo-3-hydroxy-N,N-dimethylcyclohexane-1-carboxamide. InChIKey: MACXXPMHJMPFKB-FXQIFTODSA-N.
| Molecular formula | C9H16BrNO2 |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | (1S,3S,4S)-4-bromo-3-hydroxy-N,N-dimethylcyclohexane-1-carboxamide |
| InChIKey | MACXXPMHJMPFKB-FXQIFTODSA-N |
| SMILES | CN(C)C(=O)[C@H]1CC[C@@H]([C@H](C1)O)Br |
Computed by PubChem (NCBI)