cas: 143673-66-9 — see every product listed under this CAS number, including other names
(R)-3-Isopropyl-2,5-piperizinedione, 98% (CAS 143673-66-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216890-1G |
| cas | 143673-66-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 450.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-3-propan-2-ylpiperazine-2,5-dione (CAS 143673-66-9) is a chemical compound with the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. IUPAC name: (3R)-3-propan-2-ylpiperazine-2,5-dione. InChIKey: IULFBTHVPRNQCG-ZCFIWIBFSA-N.
| Molecular formula | C7H12N2O2 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | (3R)-3-propan-2-ylpiperazine-2,5-dione |
| InChIKey | IULFBTHVPRNQCG-ZCFIWIBFSA-N |
| SMILES | CC(C)[C@@H]1C(=O)NCC(=O)N1 |
Computed by PubChem (NCBI)